cas: 503469-83-8 — see every product listed under this CAS number, including other names
Thiophene-2,5-dicarboxylic acid mono tertbutylester (CAS 503469-83-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046423-1G |
| cas | 503469-83-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 955.93 Pln | |
| Fluorochem | 5g | 3423.81 Pln |
| delivery time | 2-3 weeks |
|---|
5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid (CAS 503469-83-8) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid. InChIKey: HSAOVIQXLLDARB-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid |
| InChIKey | HSAOVIQXLLDARB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(S1)C(=O)O |
Computed by PubChem (NCBI)