Products 53229-47-3
CAS 53229-47-3 appears in our catalog under these names: Diethyl thiophene-3,4-dicarboxylate, 97%, Diethyl thiophene–3，4–dicarboxylate, Diethyl thiophene-3,4-dicarboxylate 97%, diethyl thiophene-3,4-dicarboxylate, 97%, 97%, diethyl thiophene-3,4-dicarboxylate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100mg.
Diethyl thiophene-3,4-dicarboxylate (CAS 53229-47-3) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: diethyl thiophene-3,4-dicarboxylate. InChIKey: PJZOOQHKDLZCMD-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | diethyl thiophene-3,4-dicarboxylate |
| InChIKey | PJZOOQHKDLZCMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC=C1C(=O)OCC |
Computed by PubChem (NCBI)