CAS 503469-83-8 appears in our catalog under these names: Thiophene-2,5-dicarboxylic acid mono tert butyl ester, 98%, 5-(tert-Butoxycarbonyl)thiophene-2-carboxylic acid, 98%, THIOPHENE-2,5-DICARBOXYLIC ACID MONO TERT BUTYL ESTER, 98%, 98%, Thiophene-2,5-dicarboxylic acid mono tertbutylester, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g, 25g.
5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid (CAS 503469-83-8) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid. InChIKey: HSAOVIQXLLDARB-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid |
| InChIKey | HSAOVIQXLLDARB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(S1)C(=O)O |
Computed by PubChem (NCBI)