CAS 65369-20-2 is the registry number for 1-((4-Methoxyphenyl)sulfonyl)propan-2-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-methoxyphenyl)sulfonylpropan-2-one (CAS 65369-20-2) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 1-(4-methoxyphenyl)sulfonylpropan-2-one. InChIKey: SKYVAGABDXUVRW-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)sulfonylpropan-2-one |
| InChIKey | SKYVAGABDXUVRW-UHFFFAOYSA-N |
| SMILES | CC(=O)CS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)