Products 1351636-18-4
CAS 1351636-18-4 appears in our catalog under these names: Tirabrutinib/ 99.75% (existing batch purity), Tirabrutinib, 97%, Tirabrutinib, 98+%, 98+%, Tirabrutinib, 99.71%, Tirabrutinib, 98+%. Offered by: TargetMol, Thermo Scientific (Acros), Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 5 mg, 10 mg.
Tirabrutinib is an orally available formulation containing an inhibitor of Bruton agammaglobulinemia tyrosine kinase (BTK), with potential antineoplastic activity. Upon administration, tirabrutinib covalently binds to BTK within B cells, thereby preventing B cell receptor signaling and impeding B cell development. As a result, this agent may inhibit the proliferation of B cell malignancies.
Source: ChEBI
| Molecular formula | C25H22N6O3 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 6-amino-9-[(3R)-1-but-2-ynoylpyrrolidin-3-yl]-7-(4-phenoxyphenyl)purin-8-one |
| InChIKey | SEJLPXCPMNSRAM-GOSISDBHSA-N |
| SMILES | CC#CC(=O)N1CC[C@H](C1)N2C3=NC=NC(=C3N(C2=O)C4=CC=C(C=C4)OC5=CC=CC=C5)N |
Computed by PubChem (NCBI)