cas: 2006333-41-9 — see every product listed under this CAS number, including other names
Trans-4-fluoro-3-hydroxypyrrolidine hydrochloride, 97% (CAS 2006333-41-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469513-1G |
| cas | 2006333-41-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1830.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 2006333-41-9) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-VKKIDBQXSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)