cas: 4271-99-2 — see every product listed under this CAS number, including other names
Trans-aconiticacidtrimethylester, 97%, 97% (CAS 4271-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UYP-1g |
| cas | 4271-99-2 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1269.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate (CAS 4271-99-2) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate. InChIKey: DZAIBGWGBBQGPZ-GQCTYLIASA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate |
| InChIKey | DZAIBGWGBBQGPZ-GQCTYLIASA-N |
| SMILES | COC(=O)C/C(=C\C(=O)OC)/C(=O)OC |
Computed by PubChem (NCBI)