cas: 4271-99-2 — see every product listed under this CAS number, including other names
Trimethyl trans-Aconitate, >97.0%(GC) (CAS 4271-99-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0725-5G |
| cas | 4271-99-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 369.12 Pln | |
| TCI | 25g | 1136.22 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate (CAS 4271-99-2) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate. InChIKey: DZAIBGWGBBQGPZ-GQCTYLIASA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate |
| InChIKey | DZAIBGWGBBQGPZ-GQCTYLIASA-N |
| SMILES | COC(=O)C/C(=C\C(=O)OC)/C(=O)OC |
Computed by PubChem (NCBI)