cas: 58880-19-6 — see every product listed under this CAS number, including other names
Trichostatin A, 98% (CAS 58880-19-6) is a chemical reagent available from Chemat. Available pack sizes: 5MG, 25MG, 1mg, 50mg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 471120050 |
| cas | 58880-19-6 |
| size | 5MG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5MG | 766.17 Pln | |
| Thermo Scientific (Acros) | 25MG | 2271.77 Pln | |
| Fluorochem | 1mg | 471.73 Pln | |
| Fluorochem | 5mg | 1382.86 Pln | |
| Fluorochem | 25mg | 4527.59 Pln | |
| Fluorochem | 50mg | 7625.46 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Trichostatin A is a hydroxamic acid, a trichostatin and an antibiotic antifungal agent. It has a role as a geroprotector, an EC 3.5.1.98 (histone deacetylase) inhibitor and a bacterial metabolite. It is functionally related to a (R)-trichostatic acid.
Source: ChEBI
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | (2E,4E,6R)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| InChIKey | RTKIYFITIVXBLE-QEQCGCAPSA-N |
| SMILES | C[C@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)