cas: 34081-17-9 — see every product listed under this CAS number, including other names
Tyrosine, ethyl ester, 98%, 98% (CAS 34081-17-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7QD-50mg |
| cas | 34081-17-9 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 654.80 Pln | |
| Chemat | 100mg | 1067.60 Pln | |
| Chemat | 250mg | 1773.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-3-(4-hydroxyphenyl)propanoate (CAS 34081-17-9) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 2-amino-3-(4-hydroxyphenyl)propanoate. InChIKey: SBBWEQLNKVHYCX-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 2-amino-3-(4-hydroxyphenyl)propanoate |
| InChIKey | SBBWEQLNKVHYCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)