cas: 400044-47-5 — see every product listed under this CAS number, including other names
UK‑396082 (CAS 400044-47-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T69294-25mg |
| cas | 400044-47-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 25mg | 10732.68 Pln | |
| TargetMol | 50mg | 13953.08 Pln | |
| TargetMol | 100mg | 17864.96 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
(2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid (CAS 400044-47-5) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: (2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid. InChIKey: OTDGPKRCQXSTPV-JTQLQIEISA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | (2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid |
| InChIKey | OTDGPKRCQXSTPV-JTQLQIEISA-N |
| SMILES | CCCN1C=C(N=C1)C[C@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)