cas: 400044-47-5 — see every product listed under this CAS number, including other names
UK-396082 (CAS 400044-47-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch138H8I-1mg |
| cas | 400044-47-5 |
| size | 1mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 1658.00 Pln | |
| Chemat | 5mg | 3933.20 Pln | |
| Chemat | 10mg | 5483.60 Pln | |
| Chemat | 25mg | 8114.00 Pln |
| delivery time | 3 weeks |
|---|
(2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid (CAS 400044-47-5) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: (2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid. InChIKey: OTDGPKRCQXSTPV-JTQLQIEISA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | (2S)-5-amino-2-[(1-propylimidazol-4-yl)methyl]pentanoic acid |
| InChIKey | OTDGPKRCQXSTPV-JTQLQIEISA-N |
| SMILES | CCCN1C=C(N=C1)C[C@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)