cas: 1161205-04-4 — see every product listed under this CAS number, including other names
VU0361737, 99.65% (CAS 1161205-04-4) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 500 mg, 50 mg, 10 mg, 250 mg, 1 g, 25 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-14418-10mM/1mL |
| cas | 1161205-04-4 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 500 mg | 2293.39 Pln | |
| MedChemExpress | 50 mg | 598.33 Pln | |
| MedChemExpress | 10 mg | 263.96 Pln | |
| MedChemExpress | 250 mg | 1568.93 Pln | |
| MedChemExpress | 1 g | 3380.09 Pln | |
| MedChemExpress | 25 mg | 435.79 Pln | |
| MedChemExpress | 100 mg | 839.82 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.65% |
N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide (CAS 1161205-04-4) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide. InChIKey: ARYUXFNGXHNNDM-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide |
| InChIKey | ARYUXFNGXHNNDM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)