cas: 1161205-04-4 — see every product listed under this CAS number, including other names
VU 0361737, 99%, 99% (CAS 1161205-04-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BOL-1mg |
| cas | 1161205-04-4 |
| size | 1mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 5mg | 102.80 Pln | |
| Chemat | 10mg | 112.40 Pln | |
| Chemat | 25mg | 136.40 Pln | |
| Chemat | 50mg | 179.60 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 938.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide (CAS 1161205-04-4) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide. InChIKey: ARYUXFNGXHNNDM-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide |
| InChIKey | ARYUXFNGXHNNDM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)