CAS 132373-81-0 appears in our catalog under these names: Vamicamide/ 99.81% (existing batch purity), Vamicamide. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg.
(2R,4R)-4-(dimethylamino)-2-phenyl-2-pyridin-2-ylpentanamide (CAS 132373-81-0) is a chemical compound with the molecular formula C18H23N3O and a molecular weight of 297.4 g/mol. IUPAC name: (2R,4R)-4-(dimethylamino)-2-phenyl-2-pyridin-2-ylpentanamide. InChIKey: BWNLUIXQIHPUGO-RDTXWAMCSA-N.
| Molecular formula | C18H23N3O |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | (2R,4R)-4-(dimethylamino)-2-phenyl-2-pyridin-2-ylpentanamide |
| InChIKey | BWNLUIXQIHPUGO-RDTXWAMCSA-N |
| SMILES | C[C@H](C[C@@](C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N)N(C)C |
Computed by PubChem (NCBI)