CAS 66172-75-6 appears in our catalog under these names: Verofylline/ 99.55% (existing batch purity), Verofylline 98%, Verofylline. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1,8-dimethyl-3-(2-methylbutyl)-7H-purine-2,6-dione (CAS 66172-75-6) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: 1,8-dimethyl-3-(2-methylbutyl)-7H-purine-2,6-dione. InChIKey: MTBUJUHRXVGLEF-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 1,8-dimethyl-3-(2-methylbutyl)-7H-purine-2,6-dione |
| InChIKey | MTBUJUHRXVGLEF-UHFFFAOYSA-N |
| SMILES | CCC(C)CN1C2=C(C(=O)N(C1=O)C)NC(=N2)C |
Computed by PubChem (NCBI)