Products 52211-63-9
CAS 52211-63-9 appears in our catalog under these names: Quinotoxine Hydrochloride, >95% (HPLC), Viquidil hydrochloride/ 99.37% (existing batch purity), Viquidil hydrochloride, Viquidil (hydrochloride), Viquidil (hydrochloride), 99.47%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 10mM (in 1ml water).
3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-one;hydrochloride (CAS 52211-63-9) is a chemical compound with the molecular formula C20H25ClN2O2 and a molecular weight of 360.9 g/mol. IUPAC name: 3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-one;hydrochloride. InChIKey: YUBRJAHSRSIPKX-LDXVYITESA-N.
| Molecular formula | C20H25ClN2O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-one;hydrochloride |
| InChIKey | YUBRJAHSRSIPKX-LDXVYITESA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)C(=O)CC[C@@H]3CCNC[C@@H]3C=C.Cl |
Computed by PubChem (NCBI)