CAS 442571-27-9 appears in our catalog under these names: 2–((5,6–Dimethylthieno(2,3–d)pyrimidin–4–yl)thio)propanoic acid, WAY-297174/ 99.43% (existing batch purity), 2-((5,6-Dimethylthieno[2,3-d]pyrimidin-4-yl)thio)propanoic acid, 98%, 98%, CK2-IN-8. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 10 mg.
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoic acid (CAS 442571-27-9) is a chemical compound with the molecular formula C11H12N2O2S2 and a molecular weight of 268.4 g/mol. IUPAC name: 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoic acid. InChIKey: XBVBOHVUUTUFDC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoic acid |
| InChIKey | XBVBOHVUUTUFDC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC=N2)SC(C)C(=O)O)C |
Computed by PubChem (NCBI)