CAS 28940-11-6 appears in our catalog under these names: Watermelon ketone/ 99.96% (existing batch purity), Watermelon ketone (7–Methyl–2H–1,5–benzodioxepin–3(4H)–one), 7-methyl-2H-benzo[b][1,4]dioxepin-3(4H)-one, 98%, 98%, Watermelon ketone, 99.97%, Watermelon ketone (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 10mM (in 1ml dmso), 1g, 10g, 25g, 10mM/1mL, 500 mg, 1 g.
7-methyl-1,5-benzodioxepin-3-one (CAS 28940-11-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-methyl-1,5-benzodioxepin-3-one. InChIKey: SWUIQEBPZIHZQS-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-methyl-1,5-benzodioxepin-3-one |
| InChIKey | SWUIQEBPZIHZQS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OCC(=O)CO2 |
Computed by PubChem (NCBI)