CAS 1360540-81-3 appears in our catalog under these names: Wnt pathway activator 1/ 99.94% (existing batch purity), Wnt pathway activator 1, Wnt pathway activator 1, dalosirvat, Dalosirvat, 98.22%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylbutane-1,4-dione (CAS 1360540-81-3) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylbutane-1,4-dione. InChIKey: AOCDRSSVFUCURK-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylbutane-1,4-dione |
| InChIKey | AOCDRSSVFUCURK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)