CAS 58131-57-0 appears in our catalog under these names: NSC 207895 (XI–006), XI-006/ 99.12% (existing batch purity), NSC 207895, NSC-207895 99%, 2,1,3-Benzoxadiazole, 4-(4-methyl-1-piperazinyl)-7-nitro-, 3-oxide, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 200mg, 5mg, 50mg, 1mg, 2mg, 25mg, 100mg.
4-(4-methylpiperazin-1-yl)-7-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium (CAS 58131-57-0) is a chemical compound with the molecular formula C11H13N5O4 and a molecular weight of 279.25 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)-7-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium. InChIKey: MWFZDJLPWDCQIL-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O4 |
|---|---|
| Molecular weight | 279.25 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)-7-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium |
| InChIKey | MWFZDJLPWDCQIL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C3=NO[N+](=C23)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)