CAS 53439-81-9 appears in our catalog under these names: XU1/ 98.97% (existing batch purity), XU1 98%, Benzo[c][1,8]naphthyridin-6(5h)-One. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
5H-benzo[c][1,8]naphthyridin-6-one (CAS 53439-81-9) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 5H-benzo[c][1,8]naphthyridin-6-one. InChIKey: YLSBDRGLLZDAKB-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5H-benzo[c][1,8]naphthyridin-6-one |
| InChIKey | YLSBDRGLLZDAKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(NC2=O)N=CC=C3 |
Computed by PubChem (NCBI)