Yohimbine (Hydrochloride), 99.92%
cas: 65-19-0 — see every product listed under this CAS number, including other names
Yohimbine (Hydrochloride), 99.92% (CAS 65-19-0) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10 g, 5 g, 500 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N0127-1 g |
| cas | 65-19-0 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 10 g | 1081.31 Pln | |
| MedChemExpress | 5 g | 719.08 Pln | |
| MedChemExpress | 500 mg | 263.96 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.92% |
Methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride (CAS 65-19-0) is a chemical compound with the molecular formula C21H27ClN2O3 and a molecular weight of 390.9 g/mol. IUPAC name: methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride. InChIKey: PIPZGJSEDRMUAW-VJDCAHTMSA-N.
| Molecular formula | C21H27ClN2O3 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride |
| InChIKey | PIPZGJSEDRMUAW-VJDCAHTMSA-N |
| SMILES | COC(=O)[C@H]1[C@H](CC[C@@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O.Cl |
Computed by PubChem (NCBI)