cas: 65-19-0 — see every product listed under this CAS number, including other names
Yohimbine Hydrochloride (CAS 65-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10mg, 1g, 10mM (in 1ml dmso), 500mg, 10g, 5g, 25g. Offered by: Mikromol, LoGiCal, Dr. Ehrenstorfer, GLPBio.
| brand | Mikromol |
|---|---|
| catalog number | MM1071.00 |
| cas | 65-19-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Mikromol | 250mg | price on request | |
| LoGiCal | 10mg | price on request | |
| Dr. Ehrenstorfer | 250mg | price on request | |
| GLPBio | 1g | 625.12 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 625.12 Pln | |
| GLPBio | 500mg | 583.00 Pln | |
| Biosynth | 10g | price on request | |
| Biosynth | 5g | price on request | |
| Biosynth | 25g | price on request | |
| Sigma-Aldrich | 500MG | 862.60 Pln | |
| Sigma-Aldrich | 1EA | 665.70 Pln | |
| Sigma-Aldrich | 10G | 1260.00 Pln | |
| Sigma-Aldrich | 1G | 422.00 Pln | |
| Sigma-Aldrich | 25G | 1930.00 Pln | |
| Sigma-Aldrich | 5G | 771.00 Pln | |
| Sigma-Aldrich | 50MG | 484.20 Pln | |
| HPC Standards | 1x250mg | 708.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride (CAS 65-19-0) is a chemical compound with the molecular formula C21H27ClN2O3 and a molecular weight of 390.9 g/mol. IUPAC name: methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride. InChIKey: PIPZGJSEDRMUAW-VJDCAHTMSA-N.
| Molecular formula | C21H27ClN2O3 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride |
| InChIKey | PIPZGJSEDRMUAW-VJDCAHTMSA-N |
| SMILES | COC(=O)[C@H]1[C@H](CC[C@@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O.Cl |
Computed by PubChem (NCBI)