cas: 115909-91-6 — see every product listed under this CAS number, including other names
Z-4-(2-hydroxy-ethyl)piperidine 98% (CAS 115909-91-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A734210-250mg |
| cas | 115909-91-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 3001.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A734210 |
Benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate (CAS 115909-91-6) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate. InChIKey: SYXSMTCXQUGEIJ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate |
| InChIKey | SYXSMTCXQUGEIJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CCO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)