Z-ALA-LEU-OH, 98%(LC-MS),RG, 98%(LC-MS),RG
cas: 24959-68-0 — see every product listed under this CAS number, including other names
Z-ALA-LEU-OH, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 24959-68-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PZB-250mg |
| cas | 24959-68-0 |
| size | 250mg |
| availability | 150g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 25g | 1134.80 Pln |
properties
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid (CAS 24959-68-0) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: 4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid. InChIKey: YRQTWFBFEXBEQX-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid |
| InChIKey | YRQTWFBFEXBEQX-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C(C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)