cas: 65706-99-2 — see every product listed under this CAS number, including other names
Z-D-Glu-OBzl, 98% (CAS 65706-99-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F222213-10G |
| cas | 65706-99-2 |
| size | 10g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 242.64 Pln | |
| Fluorochem | 100g | 778.91 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 770.88 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4R)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 65706-99-2) is a chemical compound with the molecular formula C20H21NO6 and a molecular weight of 371.4 g/mol. IUPAC name: (4R)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: VWHKODOUMSMUAF-QGZVFWFLSA-N.
| Molecular formula | C20H21NO6 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (4R)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | VWHKODOUMSMUAF-QGZVFWFLSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CCC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)