Products 2426665-56-5
CAS 2426665-56-5 is the registry number for Tubulin polymerization-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-amino-6-ethoxy-1-benzofuran-3-yl)-(3,4,5-trimethoxyphenyl)methanone (CAS 2426665-56-5) is a chemical compound with the molecular formula C20H21NO6 and a molecular weight of 371.4 g/mol. IUPAC name: (2-amino-6-ethoxy-1-benzofuran-3-yl)-(3,4,5-trimethoxyphenyl)methanone. InChIKey: IAMUDZMYQAUMFC-UHFFFAOYSA-N.
| Molecular formula | C20H21NO6 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (2-amino-6-ethoxy-1-benzofuran-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | IAMUDZMYQAUMFC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C(=C(O2)N)C(=O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-13, orb1688553