CAS 5680-86-4 appears in our catalog under these names: Z-Glu(obzl)-OH, 97%, Z–Glu(OBzl)–OH, Z-L-Glu(OBzl)-OH, 5-Benzyl N-Benzyloxycarbonyl-L-glutamate, >98.0%(HPLC)(T), Z-Glu(OBzl)-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g, 25 g, 100 g.
(2S)-5-oxo-5-phenylmethoxy-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 5680-86-4) is a chemical compound with the molecular formula C20H21NO6 and a molecular weight of 371.4 g/mol. IUPAC name: (2S)-5-oxo-5-phenylmethoxy-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: TWIVXHQQTRSWGO-KRWDZBQOSA-N.
| Molecular formula | C20H21NO6 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (2S)-5-oxo-5-phenylmethoxy-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | TWIVXHQQTRSWGO-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)