CAS 717131-41-4 appears in our catalog under these names: 2-(Methyl-[3-(3,4,5-trimethoxy-phenyl)-acryloyl]-amino)-benzoic acid, 95%, 2-(N-Methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[methyl-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzoic acid (CAS 717131-41-4) is a chemical compound with the molecular formula C20H21NO6 and a molecular weight of 371.4 g/mol. IUPAC name: 2-[methyl-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: YOISROUYNXCHQJ-MDZDMXLPSA-N.
| Molecular formula | C20H21NO6 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 2-[methyl-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| InChIKey | YOISROUYNXCHQJ-MDZDMXLPSA-N |
| SMILES | CN(C1=CC=CC=C1C(=O)O)C(=O)/C=C/C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)