cas: 5672-83-3 — see every product listed under this CAS number, including other names
Z-Glu-OMe, 98% (CAS 5672-83-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352399-250mg |
| cas | 5672-83-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 414.88 Pln | |
| Ambeed | 500g | 1783.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 5672-83-3) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: (4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: BGMCTGARFXPQML-NSHDSACASA-N.
| Molecular formula | C14H17NO6 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | BGMCTGARFXPQML-NSHDSACASA-N |
| SMILES | COC(=O)[C@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)