Products 926190-67-2

CAS 926190-67-2 is the registry number for 5-Oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxylic acid (CAS 926190-67-2) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: 5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxylic acid. InChIKey: KJGIGHRIXXBYRO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO6
Molecular weight295.29 g/mol
IUPAC name5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxylic acid
InChIKeyKJGIGHRIXXBYRO-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)