Products 182001-76-9

CAS 182001-76-9 is the registry number for 3-{[(Benzyloxy)carbonyl](2-carboxyethyl)amino}propanoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[2-carboxyethyl(phenylmethoxycarbonyl)amino]propanoic acid (CAS 182001-76-9) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: 3-[2-carboxyethyl(phenylmethoxycarbonyl)amino]propanoic acid. InChIKey: BQTRRUDIWGZIBX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO6
Molecular weight295.29 g/mol
IUPAC name3-[2-carboxyethyl(phenylmethoxycarbonyl)amino]propanoic acid
InChIKeyBQTRRUDIWGZIBX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)N(CCC(=O)O)CCC(=O)O

Computed by PubChem (NCBI)