CAS 1397207-93-0 is the registry number for {[(7-hydroxy-4-methyl-2-oxochromen-6-yl)methyl](methyl)amino}acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[(7-hydroxy-4-methyl-2-oxochromen-6-yl)methyl-methylamino]acetic acid;hydrate (CAS 1397207-93-0) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: 2-[(7-hydroxy-4-methyl-2-oxochromen-6-yl)methyl-methylamino]acetic acid;hydrate. InChIKey: ZOEYPCPSFKHAHS-UHFFFAOYSA-N.
| Molecular formula | C14H17NO6 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-[(7-hydroxy-4-methyl-2-oxochromen-6-yl)methyl-methylamino]acetic acid;hydrate |
| InChIKey | ZOEYPCPSFKHAHS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=C(C(=C2)O)CN(C)CC(=O)O.O |
Computed by PubChem (NCBI)