cas: 35909-92-3 — see every product listed under this CAS number, including other names
Z-L-phenylalanine methyl ester, 98% (CAS 35909-92-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A554828-25g |
| cas | 35909-92-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 15049.51 Pln | |
| Fluorochem | 1g | 534.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 35909-92-3) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: BBACSHIJBOGXKL-INIZCTEOSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | BBACSHIJBOGXKL-INIZCTEOSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)