cas: 5513-40-6 — see every product listed under this CAS number, including other names
Z-TYR-OBZL, 97%, 97% (CAS 5513-40-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DADS-250mg |
| cas | 5513-40-6 |
| size | 250mg |
| availability | 655g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 50g | 294.80 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 250g | 1000.40 Pln | |
| Chemat | 500g | 2006.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 5513-40-6) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: MUSDDUICYXQXRT-QFIPXVFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | MUSDDUICYXQXRT-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)