CAS 92455-53-3 appears in our catalog under these names: Z-D-Tyr(bzl)-oh, 95%, Z-D-Tyr(Bzl)-OH, 98%, Z–D–Tyr(Bzl)–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 25g, 5g.
(2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 92455-53-3) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: IPAODWFPTVIUSZ-JOCHJYFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | IPAODWFPTVIUSZ-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@H](C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)