CAS 920306-95-2 appears in our catalog under these names: Cbz-D-Tyr-OBzl 98%, Benzyl ((benzyloxy)carbonyl)-D-tyrosinate, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Benzyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 920306-95-2) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: benzyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: MUSDDUICYXQXRT-JOCHJYFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | benzyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | MUSDDUICYXQXRT-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CC2=CC=C(C=C2)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)