CAS 5513-40-6 appears in our catalog under these names: Z–Tyr–OBzl, Z-Tyr-OBzl, Z-Tyr-OBzl 97%, Z-TYR-OBZL, 97%, 97%, Z-Tyr-OBzl, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 0,1kg, 250mg, 1g, 10g, 100g, 500g.
Benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 5513-40-6) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: MUSDDUICYXQXRT-QFIPXVFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | benzyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | MUSDDUICYXQXRT-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)