cas: 16677-29-5 — see every product listed under this CAS number, including other names
Z-Tyr(Bzl)-OH, 99% (CAS 16677-29-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch112WY4-5g |
| cas | 16677-29-5 |
| size | 5g |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 952.40 Pln | |
| BLDpharm | 5g | 142.20 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 880.83 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 16677-29-5) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: IPAODWFPTVIUSZ-QFIPXVFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | IPAODWFPTVIUSZ-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)