CAS 16677-29-5 appears in our catalog under these names: Z–Tyr(Bzl)–OH, Z-L-Tyr(Bzl)-OH, Cbz-Tyr(Bzl)-OH 98%, Z-Tyr(Bzl)-OH, 98%, 98%, Z-Tyr(Bzl)-OH, ≥98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g.
(2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 16677-29-5) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: IPAODWFPTVIUSZ-QFIPXVFZSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | IPAODWFPTVIUSZ-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)