CAS 71555-25-4 appears in our catalog under these names: NSC 319726, ZMC1/ 97.48% (existing batch purity), NSC319726 98%, 1-Azetidinecarbothioic acid, 2-[1-(2-pyridinyl)ethylidene]hydrazide, 98%, 98%, NSC319726, 99.60%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 2mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
N-[(E)-1-pyridin-2-ylethylideneamino]azetidine-1-carbothioamide (CAS 71555-25-4) is a chemical compound with the molecular formula C11H14N4S and a molecular weight of 234.32 g/mol. IUPAC name: N-[(E)-1-pyridin-2-ylethylideneamino]azetidine-1-carbothioamide. InChIKey: XDHBUMNIQRLHGO-UKTHLTGXSA-N.
| Molecular formula | C11H14N4S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | N-[(E)-1-pyridin-2-ylethylideneamino]azetidine-1-carbothioamide |
| InChIKey | XDHBUMNIQRLHGO-UKTHLTGXSA-N |
| SMILES | C/C(=N\NC(=S)N1CCC1)/C2=CC=CC=N2 |
Computed by PubChem (NCBI)