CAS 887603-94-3 appears in our catalog under these names: ZSET1446/ 99.32% (existing batch purity), ZSET1446 (ST–101), ZSET1446, ZSET1446 97%, ZSET1446, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
Spiro[1,3-dihydroindene-2,3'-imidazo[1,2-a]pyridine]-2'-one (CAS 887603-94-3) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: spiro[1,3-dihydroindene-2,3'-imidazo[1,2-a]pyridine]-2'-one. InChIKey: QZWYXEBIQWJXAR-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | spiro[1,3-dihydroindene-2,3'-imidazo[1,2-a]pyridine]-2'-one |
| InChIKey | QZWYXEBIQWJXAR-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC13C(=O)N=C4N3C=CC=C4 |
Computed by PubChem (NCBI)