cas: 7481-89-2 — see every product listed under this CAS number, including other names
Zalcitabine 99% (CAS 7481-89-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310205-1mg |
| cas | 7481-89-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 10mg | 159.00 Pln | |
| Ambeed | 50mg | 186.81 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A310205 |
Zalcitabine is a pyrimidine 2',3'-dideoxyribonucleoside compound having cytosine as the nucleobase. It has a role as an antimetabolite, an antiviral drug and a HIV-1 reverse transcriptase inhibitor.
Source: ChEBI
| Molecular formula | C9H13N3O3 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 4-amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | WREGKURFCTUGRC-POYBYMJQSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)