CAS 1339046-59-1 is the registry number for 1-N-(2-Methoxyethyl)-4-nitrobenzene-1,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-N-(2-methoxyethyl)-4-nitrobenzene-1,3-diamine (CAS 1339046-59-1) is a chemical compound with the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. IUPAC name: 1-N-(2-methoxyethyl)-4-nitrobenzene-1,3-diamine. InChIKey: ZTVZFGGCSJBRDA-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O3 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 1-N-(2-methoxyethyl)-4-nitrobenzene-1,3-diamine |
| InChIKey | ZTVZFGGCSJBRDA-UHFFFAOYSA-N |
| SMILES | COCCNC1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)