CAS 1423037-50-6 is the registry number for (4-Formyl-1h-[1,2,3]-triazol-1-yl)methyl pivalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-formyltriazol-1-yl)methyl 2,2-dimethylpropanoate (CAS 1423037-50-6) is a chemical compound with the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. IUPAC name: (4-formyltriazol-1-yl)methyl 2,2-dimethylpropanoate. InChIKey: KTFUKWKKZPTHSS-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O3 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | (4-formyltriazol-1-yl)methyl 2,2-dimethylpropanoate |
| InChIKey | KTFUKWKKZPTHSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCN1C=C(N=N1)C=O |
Computed by PubChem (NCBI)