CAS 664972-87-6 is the registry number for 2-Methyl-2-[(3-nitro-2-pyridinyl)amino]-1-propanol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 50g, 1g, 25g, 5g.
2-methyl-2-[(3-nitro-2-pyridinyl)amino]propan-1-ol (CAS 664972-87-6) is a chemical compound with the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. IUPAC name: 2-methyl-2-[(3-nitro-2-pyridinyl)amino]propan-1-ol. InChIKey: SMQDTERAAKSETI-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O3 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-methyl-2-[(3-nitro-2-pyridinyl)amino]propan-1-ol |
| InChIKey | SMQDTERAAKSETI-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)