adamantane-1,3,5-triol, 98%
cas: 99181-50-7 — see every product listed under this CAS number, including other names
adamantane-1,3,5-triol, 98% (CAS 99181-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114DG4-100mg |
| cas | 99181-50-7 |
| size | 100mg |
| availability | 1500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 386.00 Pln | |
| Chemat | 25g | 654.80 Pln | |
| Chemat | 100g | 1744.40 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 5g | 310.32 Pln | |
| Fluorochem | 10g | 508.17 Pln | |
| Fluorochem | 25g | 1106.92 Pln | |
| Fluorochem | 100g | 3585.21 Pln | |
| Fluorochem | 500g | 7667.11 Pln | |
| Fluorochem | 1kg | 15284.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Adamantane-1,3,5-triol (CAS 99181-50-7) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: adamantane-1,3,5-triol. InChIKey: MCYBYTIPMYLHAK-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | adamantane-1,3,5-triol |
| InChIKey | MCYBYTIPMYLHAK-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1(CC(C2)(C3)O)O)O |
Computed by PubChem (NCBI)