CAS 91057-32-8 appears in our catalog under these names: 1,3,3-Trimethyl-5-oxocyclohexanecarboxylic acid, 95%, 1,3,3–Trimethyl–5–oxocyclohexanecarboxylic acid, 1,3,3-Trimethyl-5-oxocyclohexanecarboxylic acid, 95%, 95%, 1,3,3-Trimethyl-5-oxocyclohexane-1-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,3,3-trimethyl-5-oxocyclohexane-1-carboxylic acid (CAS 91057-32-8) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 1,3,3-trimethyl-5-oxocyclohexane-1-carboxylic acid. InChIKey: SGFBPPHVKLFHLR-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 1,3,3-trimethyl-5-oxocyclohexane-1-carboxylic acid |
| InChIKey | SGFBPPHVKLFHLR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CC(C1)(C)C(=O)O)C |
Computed by PubChem (NCBI)