CAS 82114-19-0 appears in our catalog under these names: amflutizole/ 99.61% (existing batch purity), 4-Amino-3-(3-(trifluoromethyl)phenyl)isothiazole-5-carboxylic acid, Amflutizole. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg.
4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylic acid (CAS 82114-19-0) is a chemical compound with the molecular formula C11H7F3N2O2S and a molecular weight of 288.25 g/mol. IUPAC name: 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylic acid. InChIKey: KVMCEGAWQYTFKC-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2S |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylic acid |
| InChIKey | KVMCEGAWQYTFKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NSC(=C2N)C(=O)O |
Computed by PubChem (NCBI)